C13H13BrCl2N4 — CID 107794868
4-N-(4-bromo-2,3-dichlorophenyl)-2-propylpyrimidine-4,6-diamine (PubChem CID 107794868) has the molecular formula C13H13BrCl2N4 and a molecular weight of 376.09 g/mol. Its IUPAC name is 4-N-(4-bromo-2,3-dichlorophenyl)-2-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-bromo-2,3-dichlorophenyl)-2-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107794868 |
| Molecular Formula | C13H13BrCl2N4 |
| Molecular Weight | 376.09 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 4-N-(4-bromo-2,3-dichlorophenyl)-2-propylpyrimidine-4,6-diamine |
| SMILES | CCCc1nc(N)cc(Nc2ccc(Br)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C13H13BrCl2N4/c1-2-3-10-19-9(17)6-11(20-10)18-8-5-4-7(14)12(15)13(8)16/h4-6H,2-3H2,1H3,(H3,17,18,19,20) |
| InChIKey | GLZYCQGWCOGNMP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.09 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|