C13H14BrCl2N5 — CID 107795388
N-(4-bromo-2,3-dichlorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine (PubChem CID 107795388) has the molecular formula C13H14BrCl2N5 and a molecular weight of 391.10 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107795388 |
| Molecular Formula | C13H14BrCl2N5 |
| Molecular Weight | 391.10 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(NN)cc(Nc2ccc(Br)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C13H14BrCl2N5/c1-2-3-9-19-10(6-11(20-9)21-17)18-8-5-4-7(14)12(15)13(8)16/h4-6H,2-3,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | VFQNLNHCMQHHAU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.10 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|