C13H14Cl2FN5 — CID 83073478
N-(2,6-dichloro-4-fluorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine (PubChem CID 83073478) has the molecular formula C13H14Cl2FN5 and a molecular weight of 330.19 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83073478 |
| Molecular Formula | C13H14Cl2FN5 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(NN)cc(Nc2c(Cl)cc(F)cc2Cl)n1 |
| InChI | InChI=1S/C13H14Cl2FN5/c1-2-3-10-18-11(6-12(19-10)21-17)20-13-8(14)4-7(16)5-9(13)15/h4-6H,2-3,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | DFULTXXQPXUABO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|