C13H11BrCl2FN3 — CID 107614936
N-(2-bromo-6-chloro-4-fluorophenyl)-6-chloro-2-propylpyrimidin-4-amine (PubChem CID 107614936) has the molecular formula C13H11BrCl2FN3 and a molecular weight of 379.06 g/mol. Its IUPAC name is N-(2-bromo-6-chloro-4-fluorophenyl)-6-chloro-2-propylpyrimidin-4-amine.
| Compound Name | N-(2-bromo-6-chloro-4-fluorophenyl)-6-chloro-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107614936 |
| Molecular Formula | C13H11BrCl2FN3 |
| Molecular Weight | 379.06 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | N-(2-bromo-6-chloro-4-fluorophenyl)-6-chloro-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cl)cc(Nc2c(Cl)cc(F)cc2Br)n1 |
| InChI | InChI=1S/C13H11BrCl2FN3/c1-2-3-11-18-10(16)6-12(19-11)20-13-8(14)4-7(17)5-9(13)15/h4-6H,2-3H2,1H3,(H,18,19,20) |
| InChIKey | NEMQFKCUKJYZKA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.06 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |