C12H9BrCl2FN3O — CID 107614938
N-(2-bromo-6-chloro-4-fluorophenyl)-6-chloro-2-(methoxymethyl)pyrimidin-4-amine (PubChem CID 107614938) has the molecular formula C12H9BrCl2FN3O and a molecular weight of 381.03 g/mol. Its IUPAC name is N-(2-bromo-6-chloro-4-fluorophenyl)-6-chloro-2-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | N-(2-bromo-6-chloro-4-fluorophenyl)-6-chloro-2-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107614938 |
| Molecular Formula | C12H9BrCl2FN3O |
| Molecular Weight | 381.03 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | N-(2-bromo-6-chloro-4-fluorophenyl)-6-chloro-2-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(Cl)cc(Nc2c(Cl)cc(F)cc2Br)n1 |
| InChI | InChI=1S/C12H9BrCl2FN3O/c1-20-5-11-17-9(15)4-10(18-11)19-12-7(13)2-6(16)3-8(12)14/h2-4H,5H2,1H3,(H,17,18,19) |
| InChIKey | NXCUTTRZEJHVOD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.03 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |