C12H10Cl2FN3O — CID 107530548
6-chloro-N-(2-chloro-5-fluorophenyl)-2-(methoxymethyl)pyrimidin-4-amine (PubChem CID 107530548) has the molecular formula C12H10Cl2FN3O and a molecular weight of 302.14 g/mol. Its IUPAC name is 6-chloro-N-(2-chloro-5-fluorophenyl)-2-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2-chloro-5-fluorophenyl)-2-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107530548 |
| Molecular Formula | C12H10Cl2FN3O |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 6-chloro-N-(2-chloro-5-fluorophenyl)-2-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(Cl)cc(Nc2cc(F)ccc2Cl)n1 |
| InChI | InChI=1S/C12H10Cl2FN3O/c1-19-6-12-17-10(14)5-11(18-12)16-9-4-7(15)2-3-8(9)13/h2-5H,6H2,1H3,(H,16,17,18) |
| InChIKey | MRTOBVYLQWZQQQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |