C14H15ClFN3O — CID 82463163
6-chloro-N-[2-(4-fluorophenyl)ethyl]-2-(methoxymethyl)pyrimidin-4-amine (PubChem CID 82463163) has the molecular formula C14H15ClFN3O and a molecular weight of 295.75 g/mol. Its IUPAC name is 6-chloro-N-[2-(4-fluorophenyl)ethyl]-2-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[2-(4-fluorophenyl)ethyl]-2-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 82463163 |
| Molecular Formula | C14H15ClFN3O |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 6-chloro-N-[2-(4-fluorophenyl)ethyl]-2-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(Cl)cc(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C14H15ClFN3O/c1-20-9-14-18-12(15)8-13(19-14)17-7-6-10-2-4-11(16)5-3-10/h2-5,8H,6-7,9H2,1H3,(H,17,18,19) |
| InChIKey | QMYGUOXDQQKPJE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |