C10H17ClN4O3S — CID 106341586
2-[[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]amino]-N-ethylethanesulfonamide (PubChem CID 106341586) has the molecular formula C10H17ClN4O3S and a molecular weight of 308.79 g/mol. Its IUPAC name is 2-[[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 106341586 |
| Molecular Formula | C10H17ClN4O3S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-[[6-chloro-2-(methoxymethyl)pyrimidin-4-yl]amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1cc(Cl)nc(COC)n1 |
| InChI | InChI=1S/C10H17ClN4O3S/c1-3-13-19(16,17)5-4-12-9-6-8(11)14-10(15-9)7-18-2/h6,13H,3-5,7H2,1-2H3,(H,12,14,15) |
| InChIKey | OIWPKGRDKKKJKI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |