C10H20N6O3S — CID 106341151
2-[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]amino]-N,N-dimethylethanesulfonamide (PubChem CID 106341151) has the molecular formula C10H20N6O3S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]amino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]amino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106341151 |
| Molecular Formula | C10H20N6O3S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]amino]-N,N-dimethylethanesulfonamide |
| SMILES | COCc1nc(NN)cc(NCCS(=O)(=O)N(C)C)n1 |
| InChI | InChI=1S/C10H20N6O3S/c1-16(2)20(17,18)5-4-12-8-6-9(15-11)14-10(13-8)7-19-3/h6H,4-5,7,11H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | NVNZIENFZFBTEK-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|