C11H18N6O2 — CID 113401871
5-[[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]amino]methyl]pyrrolidin-2-one (PubChem CID 113401871) has the molecular formula C11H18N6O2 and a molecular weight of 266.31 g/mol. Its IUPAC name is 5-[[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]amino]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]amino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 113401871 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-[[[6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-yl]amino]methyl]pyrrolidin-2-one |
| SMILES | COCc1nc(NN)cc(NCC2CCC(=O)N2)n1 |
| InChI | InChI=1S/C11H18N6O2/c1-19-6-10-15-8(4-9(16-10)17-12)13-5-7-2-3-11(18)14-7/h4,7H,2-3,5-6,12H2,1H3,(H,14,18)(H2,13,15,16,17) |
| InChIKey | IPOHQYCJKGMORL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|