C8H17N7O3S — CID 106341167
2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-N,N-dimethylethanesulfonamide (PubChem CID 106341167) has the molecular formula C8H17N7O3S and a molecular weight of 291.34 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106341167 |
| Molecular Formula | C8H17N7O3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)amino]-N,N-dimethylethanesulfonamide |
| SMILES | COc1nc(NN)nc(NCCS(=O)(=O)N(C)C)n1 |
| InChI | InChI=1S/C8H17N7O3S/c1-15(2)19(16,17)5-4-10-6-11-7(14-9)13-8(12-6)18-3/h4-5,9H2,1-3H3,(H2,10,11,12,13,14) |
| InChIKey | PQFBNSMDUYLTFE-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|