C9H14N8O — CID 80896292
4-hydrazinyl-6-methoxy-N-(2-pyrazol-1-ylethyl)-1,3,5-triazin-2-amine (PubChem CID 80896292) has the molecular formula C9H14N8O and a molecular weight of 250.27 g/mol. Its IUPAC name is 4-hydrazinyl-6-methoxy-N-(2-pyrazol-1-ylethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-methoxy-N-(2-pyrazol-1-ylethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80896292 |
| Molecular Formula | C9H14N8O |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 4-hydrazinyl-6-methoxy-N-(2-pyrazol-1-ylethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NN)nc(NCCn2cccn2)n1 |
| InChI | InChI=1S/C9H14N8O/c1-18-9-14-7(13-8(15-9)16-10)11-4-6-17-5-2-3-12-17/h2-3,5H,4,6,10H2,1H3,(H2,11,13,14,15,16) |
| InChIKey | YKRBBDJAUYYBRB-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|