C10H14N6OS — CID 80943741
4-hydrazinyl-6-methoxy-N-(2-thiophen-2-ylethyl)-1,3,5-triazin-2-amine (PubChem CID 80943741) has the molecular formula C10H14N6OS and a molecular weight of 266.33 g/mol. Its IUPAC name is 4-hydrazinyl-6-methoxy-N-(2-thiophen-2-ylethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-methoxy-N-(2-thiophen-2-ylethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80943741 |
| Molecular Formula | C10H14N6OS |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-hydrazinyl-6-methoxy-N-(2-thiophen-2-ylethyl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NN)nc(NCCc2cccs2)n1 |
| InChI | InChI=1S/C10H14N6OS/c1-17-10-14-8(13-9(15-10)16-11)12-5-4-7-3-2-6-18-7/h2-3,6H,4-5,11H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | CXFJILIPLRDWRA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|