C9H12N6O2 — CID 80932085
N-(furan-2-ylmethyl)-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 80932085) has the molecular formula C9H12N6O2 and a molecular weight of 236.24 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80932085 |
| Molecular Formula | C9H12N6O2 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NN)nc(NCc2ccco2)n1 |
| InChI | InChI=1S/C9H12N6O2/c1-16-9-13-7(12-8(14-9)15-10)11-5-6-3-2-4-17-6/h2-4H,5,10H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | UTGVGTJRLFQDRN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|