C11H16N6O2 — CID 80932923
N-(furan-2-ylmethyl)-4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 80932923) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80932923 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | CC(C)Oc1nc(NN)nc(NCc2ccco2)n1 |
| InChI | InChI=1S/C11H16N6O2/c1-7(2)19-11-15-9(14-10(16-11)17-12)13-6-8-4-3-5-18-8/h3-5,7H,6,12H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | YLDIPHNLGIVXOS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|