C9H17N7O2 — CID 80905968
3-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]propanamide (PubChem CID 80905968) has the molecular formula C9H17N7O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]propanamide.
| Compound Name | 3-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 80905968 |
| Molecular Formula | C9H17N7O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]propanamide |
| SMILES | CC(C)Oc1nc(NN)nc(NCCC(N)=O)n1 |
| InChI | InChI=1S/C9H17N7O2/c1-5(2)18-9-14-7(12-4-3-6(10)17)13-8(15-9)16-11/h5H,3-4,11H2,1-2H3,(H2,10,17)(H2,12,13,14,15,16) |
| InChIKey | PTARGZMBLOBNFV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|