C13H27N7O — CID 80938206
N',N'-diethyl-N-(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)propane-1,3-diamine (PubChem CID 80938206) has the molecular formula C13H27N7O and a molecular weight of 297.41 g/mol. Its IUPAC name is N',N'-diethyl-N-(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 80938206 |
| Molecular Formula | C13H27N7O |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | N',N'-diethyl-N-(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(NN)nc(OC(C)C)n1 |
| InChI | InChI=1S/C13H27N7O/c1-5-20(6-2)9-7-8-15-11-16-12(19-14)18-13(17-11)21-10(3)4/h10H,5-9,14H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | RHVVNWOFHAMXPH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|