C12H25N7O — CID 80932481
N',N'-diethyl-N-(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)ethane-1,2-diamine (PubChem CID 80932481) has the molecular formula C12H25N7O and a molecular weight of 283.38 g/mol. Its IUPAC name is N',N'-diethyl-N-(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 80932481 |
| Molecular Formula | C12H25N7O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N',N'-diethyl-N-(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1nc(NN)nc(OC(C)C)n1 |
| InChI | InChI=1S/C12H25N7O/c1-5-19(6-2)8-7-14-10-15-11(18-13)17-12(16-10)20-9(3)4/h9H,5-8,13H2,1-4H3,(H2,14,15,16,17,18) |
| InChIKey | GMJDKYSEHLVKMQ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|