C9H18N8O2 — CID 83117573
2-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]ethylurea (PubChem CID 83117573) has the molecular formula C9H18N8O2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]ethylurea.
| Compound Name | 2-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83117573 |
| Molecular Formula | C9H18N8O2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-[(4-hydrazinyl-6-propan-2-yloxy-1,3,5-triazin-2-yl)amino]ethylurea |
| SMILES | CC(C)Oc1nc(NN)nc(NCCNC(N)=O)n1 |
| InChI | InChI=1S/C9H18N8O2/c1-5(2)19-9-15-7(14-8(16-9)17-11)13-4-3-12-6(10)18/h5H,3-4,11H2,1-2H3,(H3,10,12,18)(H2,13,14,15,16,17) |
| InChIKey | RRISJULELNTAAN-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|