C11H14N4O2 — CID 143835245
4-ethoxy-N-(furan-2-ylmethyl)-6-methyl-1,3,5-triazin-2-amine (PubChem CID 143835245) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-ethoxy-N-(furan-2-ylmethyl)-6-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-N-(furan-2-ylmethyl)-6-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 143835245 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 4-ethoxy-N-(furan-2-ylmethyl)-6-methyl-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(C)nc(NCc2ccco2)n1 |
| InChI | InChI=1S/C11H14N4O2/c1-3-16-11-14-8(2)13-10(15-11)12-7-9-5-4-6-17-9/h4-6H,3,7H2,1-2H3,(H,12,13,14,15) |
| InChIKey | KTRWXTWXJGGRQT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |