C11H21N7O — CID 114133549
N'-cyclopropyl-N'-ethyl-N-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)ethane-1,2-diamine (PubChem CID 114133549) has the molecular formula C11H21N7O and a molecular weight of 267.34 g/mol. Its IUPAC name is N'-cyclopropyl-N'-ethyl-N-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N'-ethyl-N-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114133549 |
| Molecular Formula | C11H21N7O |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N'-cyclopropyl-N'-ethyl-N-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)ethane-1,2-diamine |
| SMILES | CCN(CCNc1nc(NN)nc(OC)n1)C1CC1 |
| InChI | InChI=1S/C11H21N7O/c1-3-18(8-4-5-8)7-6-13-9-14-10(17-12)16-11(15-9)19-2/h8H,3-7,12H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | HXUWQRWBQKAQSB-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|