C12H17N5 — CID 80808931
2-N-ethyl-6-N-(2-pyrazol-1-ylethyl)pyridine-2,6-diamine (PubChem CID 80808931) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(2-pyrazol-1-ylethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(2-pyrazol-1-ylethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80808931 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-N-ethyl-6-N-(2-pyrazol-1-ylethyl)pyridine-2,6-diamine |
| SMILES | CCNc1cccc(NCCn2cccn2)n1 |
| InChI | InChI=1S/C12H17N5/c1-2-13-11-5-3-6-12(16-11)14-8-10-17-9-4-7-15-17/h3-7,9H,2,8,10H2,1H3,(H2,13,14,16) |
| InChIKey | VGDGWXLRURYJRS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |