C8H16N6O2S — CID 106341141
2-[(6-hydrazinylpyrimidin-4-yl)amino]-N,N-dimethylethanesulfonamide (PubChem CID 106341141) has the molecular formula C8H16N6O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-[(6-hydrazinylpyrimidin-4-yl)amino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[(6-hydrazinylpyrimidin-4-yl)amino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106341141 |
| Molecular Formula | C8H16N6O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[(6-hydrazinylpyrimidin-4-yl)amino]-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNc1cc(NN)ncn1 |
| InChI | InChI=1S/C8H16N6O2S/c1-14(2)17(15,16)4-3-10-7-5-8(13-9)12-6-11-7/h5-6H,3-4,9H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | DSCWZQKQIFYGAA-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|