C13H11BrCl2FN3 — CID 107576901
6-bromo-N-(3,5-dichloro-4-fluorophenyl)-2-propylpyrimidin-4-amine (PubChem CID 107576901) has the molecular formula C13H11BrCl2FN3 and a molecular weight of 379.06 g/mol. Its IUPAC name is 6-bromo-N-(3,5-dichloro-4-fluorophenyl)-2-propylpyrimidin-4-amine.
| Compound Name | 6-bromo-N-(3,5-dichloro-4-fluorophenyl)-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107576901 |
| Molecular Formula | C13H11BrCl2FN3 |
| Molecular Weight | 379.06 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 6-bromo-N-(3,5-dichloro-4-fluorophenyl)-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Br)cc(Nc2cc(Cl)c(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H11BrCl2FN3/c1-2-3-11-19-10(14)6-12(20-11)18-7-4-8(15)13(17)9(16)5-7/h4-6H,2-3H2,1H3,(H,18,19,20) |
| InChIKey | CHMIIZKDPYUJEP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.06 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|