C13H13Cl2FN4 — CID 107580802
4-N-(3,5-dichloro-4-fluorophenyl)-2-propan-2-ylpyrimidine-4,6-diamine (PubChem CID 107580802) has the molecular formula C13H13Cl2FN4 and a molecular weight of 315.18 g/mol. Its IUPAC name is 4-N-(3,5-dichloro-4-fluorophenyl)-2-propan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,5-dichloro-4-fluorophenyl)-2-propan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107580802 |
| Molecular Formula | C13H13Cl2FN4 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4-N-(3,5-dichloro-4-fluorophenyl)-2-propan-2-ylpyrimidine-4,6-diamine |
| SMILES | CC(C)c1nc(N)cc(Nc2cc(Cl)c(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H13Cl2FN4/c1-6(2)13-19-10(17)5-11(20-13)18-7-3-8(14)12(16)9(15)4-7/h3-6H,1-2H3,(H3,17,18,19,20) |
| InChIKey | XVXTTYYMWRFXSH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|