C13H14ClIN4 — CID 107639116
4-N-(4-chloro-2-iodophenyl)-2-propan-2-ylpyrimidine-4,6-diamine (PubChem CID 107639116) has the molecular formula C13H14ClIN4 and a molecular weight of 388.64 g/mol. Its IUPAC name is 4-N-(4-chloro-2-iodophenyl)-2-propan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-chloro-2-iodophenyl)-2-propan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107639116 |
| Molecular Formula | C13H14ClIN4 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 4-N-(4-chloro-2-iodophenyl)-2-propan-2-ylpyrimidine-4,6-diamine |
| SMILES | CC(C)c1nc(N)cc(Nc2ccc(Cl)cc2I)n1 |
| InChI | InChI=1S/C13H14ClIN4/c1-7(2)13-18-11(16)6-12(19-13)17-10-4-3-8(14)5-9(10)15/h3-7H,1-2H3,(H3,16,17,18,19) |
| InChIKey | IYSVYWGMBRLBPN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|