C12H13BrFN5O — CID 113401888
N-(4-bromo-3-fluorophenyl)-6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-amine (PubChem CID 113401888) has the molecular formula C12H13BrFN5O and a molecular weight of 342.17 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)-6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | N-(4-bromo-3-fluorophenyl)-6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 113401888 |
| Molecular Formula | C12H13BrFN5O |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)-6-hydrazinyl-2-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(NN)cc(Nc2ccc(Br)c(F)c2)n1 |
| InChI | InChI=1S/C12H13BrFN5O/c1-20-6-12-17-10(5-11(18-12)19-15)16-7-2-3-8(13)9(14)4-7/h2-5H,6,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | OMQBVVCNIDIVNU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|