C12H7BrCl2N2O3 — CID 107656699
2-(4-bromo-2,5-dichlorophenoxy)-4-methylpyrimidine-5-carboxylic acid (PubChem CID 107656699) has the molecular formula C12H7BrCl2N2O3 and a molecular weight of 378.01 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)-4-methylpyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)-4-methylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 107656699 |
| Molecular Formula | C12H7BrCl2N2O3 |
| Molecular Weight | 378.01 g/mol |
| Exact Mass | 375.90 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)-4-methylpyrimidine-5-carboxylic acid |
| SMILES | Cc1nc(Oc2cc(Cl)c(Br)cc2Cl)ncc1C(=O)O |
| InChI | InChI=1S/C12H7BrCl2N2O3/c1-5-6(11(18)19)4-16-12(17-5)20-10-3-8(14)7(13)2-9(10)15/h2-4H,1H3,(H,18,19) |
| InChIKey | KLIUYAAOKYNYKM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.01 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|