C12H9BrCl2N2O2 — CID 107660009
[2-(4-bromo-2,5-dichlorophenoxy)-4-methylpyrimidin-5-yl]methanol (PubChem CID 107660009) has the molecular formula C12H9BrCl2N2O2 and a molecular weight of 364.03 g/mol. Its IUPAC name is [2-(4-bromo-2,5-dichlorophenoxy)-4-methylpyrimidin-5-yl]methanol.
| Compound Name | [2-(4-bromo-2,5-dichlorophenoxy)-4-methylpyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 107660009 |
| Molecular Formula | C12H9BrCl2N2O2 |
| Molecular Weight | 364.03 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | [2-(4-bromo-2,5-dichlorophenoxy)-4-methylpyrimidin-5-yl]methanol |
| SMILES | Cc1nc(Oc2cc(Cl)c(Br)cc2Cl)ncc1CO |
| InChI | InChI=1S/C12H9BrCl2N2O2/c1-6-7(5-18)4-16-12(17-6)19-11-3-9(14)8(13)2-10(11)15/h2-4,18H,5H2,1H3 |
| InChIKey | AUXPFIFZISBGBE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.03 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|