C12H9Cl3N2O — CID 83184065
5-(chloromethyl)-2-(2,5-dichlorophenoxy)-4-methylpyrimidine (PubChem CID 83184065) has the molecular formula C12H9Cl3N2O and a molecular weight of 303.58 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2,5-dichlorophenoxy)-4-methylpyrimidine.
| Compound Name | 5-(chloromethyl)-2-(2,5-dichlorophenoxy)-4-methylpyrimidine |
|---|---|
| PubChem CID | 83184065 |
| Molecular Formula | C12H9Cl3N2O |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 5-(chloromethyl)-2-(2,5-dichlorophenoxy)-4-methylpyrimidine |
| SMILES | Cc1nc(Oc2cc(Cl)ccc2Cl)ncc1CCl |
| InChI | InChI=1S/C12H9Cl3N2O/c1-7-8(5-13)6-16-12(17-7)18-11-4-9(14)2-3-10(11)15/h2-4,6H,5H2,1H3 |
| InChIKey | BTRZQCPWWXSJMO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|