C12H8BrCl2NO2 — CID 107659076
[6-(4-bromo-2,5-dichlorophenoxy)-3-pyridinyl]methanol (PubChem CID 107659076) has the molecular formula C12H8BrCl2NO2 and a molecular weight of 349.01 g/mol. Its IUPAC name is [6-(4-bromo-2,5-dichlorophenoxy)-3-pyridinyl]methanol.
| Compound Name | [6-(4-bromo-2,5-dichlorophenoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 107659076 |
| Molecular Formula | C12H8BrCl2NO2 |
| Molecular Weight | 349.01 g/mol |
| Exact Mass | 346.91 |
| IUPAC Name | [6-(4-bromo-2,5-dichlorophenoxy)-3-pyridinyl]methanol |
| SMILES | OCc1ccc(Oc2cc(Cl)c(Br)cc2Cl)nc1 |
| InChI | InChI=1S/C12H8BrCl2NO2/c13-8-3-10(15)11(4-9(8)14)18-12-2-1-7(6-17)5-16-12/h1-5,17H,6H2 |
| InChIKey | ZIGDJYLTDHLXFS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.01 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|