C13H7BrCl2F2O2 — CID 107659098
[4-(4-bromo-2,5-dichlorophenoxy)-3,5-difluorophenyl]methanol (PubChem CID 107659098) has the molecular formula C13H7BrCl2F2O2 and a molecular weight of 384.00 g/mol. Its IUPAC name is [4-(4-bromo-2,5-dichlorophenoxy)-3,5-difluorophenyl]methanol.
| Compound Name | [4-(4-bromo-2,5-dichlorophenoxy)-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 107659098 |
| Molecular Formula | C13H7BrCl2F2O2 |
| Molecular Weight | 384.00 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | [4-(4-bromo-2,5-dichlorophenoxy)-3,5-difluorophenyl]methanol |
| SMILES | OCc1cc(F)c(Oc2cc(Cl)c(Br)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C13H7BrCl2F2O2/c14-7-3-9(16)12(4-8(7)15)20-13-10(17)1-6(5-19)2-11(13)18/h1-4,19H,5H2 |
| InChIKey | XLXIWFJBZLRPQI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.00 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|