C15H13BrCl2FNO — CID 107659542
N-[[4-(4-bromo-2,5-dichlorophenoxy)-3-fluorophenyl]methyl]ethanamine (PubChem CID 107659542) has the molecular formula C15H13BrCl2FNO and a molecular weight of 393.08 g/mol. Its IUPAC name is N-[[4-(4-bromo-2,5-dichlorophenoxy)-3-fluorophenyl]methyl]ethanamine.
| Compound Name | N-[[4-(4-bromo-2,5-dichlorophenoxy)-3-fluorophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 107659542 |
| Molecular Formula | C15H13BrCl2FNO |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.95 |
| IUPAC Name | N-[[4-(4-bromo-2,5-dichlorophenoxy)-3-fluorophenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(Oc2cc(Cl)c(Br)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C15H13BrCl2FNO/c1-2-20-8-9-3-4-14(13(19)5-9)21-15-7-11(17)10(16)6-12(15)18/h3-7,20H,2,8H2,1H3 |
| InChIKey | GKBANADNBDOXPA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|