C13H8Cl2F2O2 — CID 63077759
[4-(2,4-dichlorophenoxy)-3,5-difluorophenyl]methanol (PubChem CID 63077759) has the molecular formula C13H8Cl2F2O2 and a molecular weight of 305.11 g/mol. Its IUPAC name is [4-(2,4-dichlorophenoxy)-3,5-difluorophenyl]methanol.
| Compound Name | [4-(2,4-dichlorophenoxy)-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 63077759 |
| Molecular Formula | C13H8Cl2F2O2 |
| Molecular Weight | 305.11 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | [4-(2,4-dichlorophenoxy)-3,5-difluorophenyl]methanol |
| SMILES | OCc1cc(F)c(Oc2ccc(Cl)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C13H8Cl2F2O2/c14-8-1-2-12(9(15)5-8)19-13-10(16)3-7(6-18)4-11(13)17/h1-5,18H,6H2 |
| InChIKey | JVPOXJGMCFKEAK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.11 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |