C13H8ClF3O2 — CID 116689370
[4-(3-chloro-2-fluorophenoxy)-3,5-difluorophenyl]methanol (PubChem CID 116689370) has the molecular formula C13H8ClF3O2 and a molecular weight of 288.65 g/mol. Its IUPAC name is [4-(3-chloro-2-fluorophenoxy)-3,5-difluorophenyl]methanol.
| Compound Name | [4-(3-chloro-2-fluorophenoxy)-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 116689370 |
| Molecular Formula | C13H8ClF3O2 |
| Molecular Weight | 288.65 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | [4-(3-chloro-2-fluorophenoxy)-3,5-difluorophenyl]methanol |
| SMILES | OCc1cc(F)c(Oc2cccc(Cl)c2F)c(F)c1 |
| InChI | InChI=1S/C13H8ClF3O2/c14-8-2-1-3-11(12(8)17)19-13-9(15)4-7(6-18)5-10(13)16/h1-5,18H,6H2 |
| InChIKey | SGEWVUGVSAAVBN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |