C13H8ClF3O — CID 63076204
5-(chloromethyl)-1,3-difluoro-2-(2-fluorophenoxy)benzene (PubChem CID 63076204) has the molecular formula C13H8ClF3O and a molecular weight of 272.65 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-difluoro-2-(2-fluorophenoxy)benzene.
| Compound Name | 5-(chloromethyl)-1,3-difluoro-2-(2-fluorophenoxy)benzene |
|---|---|
| PubChem CID | 63076204 |
| Molecular Formula | C13H8ClF3O |
| Molecular Weight | 272.65 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 5-(chloromethyl)-1,3-difluoro-2-(2-fluorophenoxy)benzene |
| SMILES | Fc1ccccc1Oc1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C13H8ClF3O/c14-7-8-5-10(16)13(11(17)6-8)18-12-4-2-1-3-9(12)15/h1-6H,7H2 |
| InChIKey | IITYJCSQQMEMMR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|