C13H7BrF4O — CID 107088431
5-(bromomethyl)-2-(2,3-difluorophenoxy)-1,3-difluorobenzene (PubChem CID 107088431) has the molecular formula C13H7BrF4O and a molecular weight of 335.09 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(2,3-difluorophenoxy)-1,3-difluorobenzene.
| Compound Name | 5-(bromomethyl)-2-(2,3-difluorophenoxy)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 107088431 |
| Molecular Formula | C13H7BrF4O |
| Molecular Weight | 335.09 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 5-(bromomethyl)-2-(2,3-difluorophenoxy)-1,3-difluorobenzene |
| SMILES | Fc1cccc(Oc2c(F)cc(CBr)cc2F)c1F |
| InChI | InChI=1S/C13H7BrF4O/c14-6-7-4-9(16)13(10(17)5-7)19-11-3-1-2-8(15)12(11)18/h1-5H,6H2 |
| InChIKey | AZCMSBXAPBJUGQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.09 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|