C11H7BrF2N2O — CID 107088439
5-(bromomethyl)-2-(2,3-difluorophenoxy)pyrimidine (PubChem CID 107088439) has the molecular formula C11H7BrF2N2O and a molecular weight of 301.09 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(2,3-difluorophenoxy)pyrimidine.
| Compound Name | 5-(bromomethyl)-2-(2,3-difluorophenoxy)pyrimidine |
|---|---|
| PubChem CID | 107088439 |
| Molecular Formula | C11H7BrF2N2O |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 5-(bromomethyl)-2-(2,3-difluorophenoxy)pyrimidine |
| SMILES | Fc1cccc(Oc2ncc(CBr)cn2)c1F |
| InChI | InChI=1S/C11H7BrF2N2O/c12-4-7-5-15-11(16-6-7)17-9-3-1-2-8(13)10(9)14/h1-3,5-6H,4H2 |
| InChIKey | UTJVPPVNMBNSIC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|