C13H5F4NO — CID 81283926
4-(2,3-difluorophenoxy)-3,5-difluorobenzonitrile (PubChem CID 81283926) has the molecular formula C13H5F4NO and a molecular weight of 267.18 g/mol. Its IUPAC name is 4-(2,3-difluorophenoxy)-3,5-difluorobenzonitrile.
| Compound Name | 4-(2,3-difluorophenoxy)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81283926 |
| Molecular Formula | C13H5F4NO |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 4-(2,3-difluorophenoxy)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(Oc2cccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C13H5F4NO/c14-8-2-1-3-11(12(8)17)19-13-9(15)4-7(6-18)5-10(13)16/h1-5H |
| InChIKey | ROLMXYDHGIHACE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |