C13H7BrF2N2O — CID 103011501
4-(5-amino-2-bromophenoxy)-3,5-difluorobenzonitrile (PubChem CID 103011501) has the molecular formula C13H7BrF2N2O and a molecular weight of 325.11 g/mol. Its IUPAC name is 4-(5-amino-2-bromophenoxy)-3,5-difluorobenzonitrile.
| Compound Name | 4-(5-amino-2-bromophenoxy)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 103011501 |
| Molecular Formula | C13H7BrF2N2O |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 4-(5-amino-2-bromophenoxy)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(Oc2cc(N)ccc2Br)c(F)c1 |
| InChI | InChI=1S/C13H7BrF2N2O/c14-9-2-1-8(18)5-12(9)19-13-10(15)3-7(6-17)4-11(13)16/h1-5H,18H2 |
| InChIKey | OBTXSRZAXYRWQR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|