About 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile
4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile (PubChem CID 81287464) has the molecular formula C13H5ClF2N2O3
and a molecular weight of 310.64 g/mol. Its IUPAC name is 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile |
| PubChem CID | 81287464 |
| Molecular Formula | C13H5ClF2N2O3 |
| Molecular Weight | 310.64 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(Oc2cc(Cl)ccc2[N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C13H5ClF2N2O3/c14-8-1-2-11(18(19)20)12(5-8)21-13-9(15)3-7(6-17)4-10(13)16/h1-5H |
| InChIKey | RTFORAKYJVVZFW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile?
The IUPAC name of 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile (CID 81287464) is 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile?
The canonical SMILES for 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile is N#Cc1cc(F)c(Oc2cc(Cl)ccc2[N+](=O)[O-])c(F)c1.
What is the InChIKey of 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile?
The InChIKey is RTFORAKYJVVZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5ClF2N2O3/c14-8-1-2-11(18(19)20)12(5-8)21-13-9(15)3-7(6-17)4-10(13)16/h1-5H.
What are the key properties of 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile?
4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile has a molecular weight of 310.64 g/mol, XLogP of 4.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-2-nitrophenoxy)-3,5-difluorobenzonitrile is sourced from PubChem (CID 81287464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).