C17H9F2NO — CID 81287439
3,5-difluoro-4-naphthalen-2-yloxybenzonitrile (PubChem CID 81287439) has the molecular formula C17H9F2NO and a molecular weight of 281.26 g/mol. Its IUPAC name is 3,5-difluoro-4-naphthalen-2-yloxybenzonitrile.
| Compound Name | 3,5-difluoro-4-naphthalen-2-yloxybenzonitrile |
|---|---|
| PubChem CID | 81287439 |
| Molecular Formula | C17H9F2NO |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3,5-difluoro-4-naphthalen-2-yloxybenzonitrile |
| SMILES | N#Cc1cc(F)c(Oc2ccc3ccccc3c2)c(F)c1 |
| InChI | InChI=1S/C17H9F2NO/c18-15-7-11(10-20)8-16(19)17(15)21-14-6-5-12-3-1-2-4-13(12)9-14/h1-9H |
| InChIKey | VLQVWWGTMJRRNP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |