C13H8F2N2O — CID 81283347
3,5-difluoro-4-[(2-methyl-3-pyridinyl)oxy]benzonitrile (PubChem CID 81283347) has the molecular formula C13H8F2N2O and a molecular weight of 246.22 g/mol. Its IUPAC name is 3,5-difluoro-4-[(2-methyl-3-pyridinyl)oxy]benzonitrile.
| Compound Name | 3,5-difluoro-4-[(2-methyl-3-pyridinyl)oxy]benzonitrile |
|---|---|
| PubChem CID | 81283347 |
| Molecular Formula | C13H8F2N2O |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3,5-difluoro-4-[(2-methyl-3-pyridinyl)oxy]benzonitrile |
| SMILES | Cc1ncccc1Oc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C13H8F2N2O/c1-8-12(3-2-4-17-8)18-13-10(14)5-9(7-16)6-11(13)15/h2-6H,1H3 |
| InChIKey | ATOKKALCXHGTRU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |