C17H11ClF2O — CID 63565884
1-[4-(chloromethyl)-2,6-difluorophenoxy]naphthalene (PubChem CID 63565884) has the molecular formula C17H11ClF2O and a molecular weight of 304.72 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-2,6-difluorophenoxy]naphthalene.
| Compound Name | 1-[4-(chloromethyl)-2,6-difluorophenoxy]naphthalene |
|---|---|
| PubChem CID | 63565884 |
| Molecular Formula | C17H11ClF2O |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-[4-(chloromethyl)-2,6-difluorophenoxy]naphthalene |
| SMILES | Fc1cc(CCl)cc(F)c1Oc1cccc2ccccc12 |
| InChI | InChI=1S/C17H11ClF2O/c18-10-11-8-14(19)17(15(20)9-11)21-16-7-3-5-12-4-1-2-6-13(12)16/h1-9H,10H2 |
| InChIKey | UULNOPBMSZIACN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|