C15H14BrF2NO — CID 107088145
3-[4-(bromomethyl)-2,6-difluorophenoxy]-N,N-dimethylaniline (PubChem CID 107088145) has the molecular formula C15H14BrF2NO and a molecular weight of 342.18 g/mol. Its IUPAC name is 3-[4-(bromomethyl)-2,6-difluorophenoxy]-N,N-dimethylaniline.
| Compound Name | 3-[4-(bromomethyl)-2,6-difluorophenoxy]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 107088145 |
| Molecular Formula | C15H14BrF2NO |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 3-[4-(bromomethyl)-2,6-difluorophenoxy]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(Oc2c(F)cc(CBr)cc2F)c1 |
| InChI | InChI=1S/C15H14BrF2NO/c1-19(2)11-4-3-5-12(8-11)20-15-13(17)6-10(9-16)7-14(15)18/h3-8H,9H2,1-2H3 |
| InChIKey | BAPQONPXKPZZIV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|