C18H17F2NO3 — CID 67567858
3-[4-[3-(dimethylamino)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoic acid (PubChem CID 67567858) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is 3-[4-[3-(dimethylamino)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-[3-(dimethylamino)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 67567858 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-[4-[3-(dimethylamino)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1cc(F)c(Oc2cccc(N(C)C)c2)c(F)c1)C(=O)O |
| InChI | InChI=1S/C18H17F2NO3/c1-11(18(22)23)7-12-8-15(19)17(16(20)9-12)24-14-6-4-5-13(10-14)21(2)3/h4-10H,1-3H3,(H,22,23) |
| InChIKey | UKCKEVADDBGTIP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|