C36H33F5O6 — CID 159932438
ethyl (E)-3-(3,5-difluoro-4-phenoxyphenyl)-2-methylprop-2-enoate;ethyl (E)-2-methyl-3-(3,4,5-trifluorophenyl)prop-2-enoate;phenol (PubChem CID 159932438) has the molecular formula C36H33F5O6 and a molecular weight of 656.64 g/mol. Its IUPAC name is ethyl (E)-3-(3,5-difluoro-4-phenoxyphenyl)-2-methylprop-2-enoate;ethyl (E)-2-methyl-3-(3,4,5-trifluorophenyl)prop-2-enoate;phenol.
| Compound Name | ethyl (E)-3-(3,5-difluoro-4-phenoxyphenyl)-2-methylprop-2-enoate;ethyl (E)-2-methyl-3-(3,4,5-trifluorophenyl)prop-2-enoate;phenol |
|---|---|
| PubChem CID | 159932438 |
| Molecular Formula | C36H33F5O6 |
| Molecular Weight | 656.64 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | ethyl (E)-3-(3,5-difluoro-4-phenoxyphenyl)-2-methylprop-2-enoate;ethyl (E)-2-methyl-3-(3,4,5-trifluorophenyl)prop-2-enoate;phenol |
| SMILES | CCOC(=O)/C(C)=C/c1cc(F)c(F)c(F)c1.CCOC(=O)/C(C)=C/c1cc(F)c(Oc2ccccc2)c(F)c1.Oc1ccccc1 |
| InChI | InChI=1S/C18H16F2O3.C12H11F3O2.C6H6O/c1-3-22-18(21)12(2)9-13-10-15(19)17(16(20)11-13)23-14-7-5-4-6-8-14;1-3-17-12(16)7(2)4-8-5-9(13)11(15)10(14)6-8;7-6-4-2-1-3-5-6/h4-11H,3H2,1-2H3;4-6H,3H2,1-2H3;1-5,7H/b12-9+;7-4+; |
| InChIKey | NZUTVXBIRZWKQD-VBANJXRLSA-N |
| XLogP | 9.19 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.64 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|