C29H38F2O9S — CID 159588439
ethyl (E)-3-[4-[4-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propylsulfonyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate (PubChem CID 159588439) has the molecular formula C29H38F2O9S and a molecular weight of 600.68 g/mol. Its IUPAC name is ethyl (E)-3-[4-[4-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propylsulfonyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[4-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propylsulfonyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159588439 |
| Molecular Formula | C29H38F2O9S |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | ethyl (E)-3-[4-[4-[3-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]propylsulfonyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enoate |
| SMILES | CCOCCOCCOCCOCCCS(=O)(=O)c1ccc(Oc2c(F)cc(/C=C(\C)C(=O)OCC)cc2F)cc1 |
| InChI | InChI=1S/C29H38F2O9S/c1-4-35-12-13-37-16-17-38-15-14-36-11-6-18-41(33,34)25-9-7-24(8-10-25)40-28-26(30)20-23(21-27(28)31)19-22(3)29(32)39-5-2/h7-10,19-21H,4-6,11-18H2,1-3H3/b22-19+ |
| InChIKey | UICDFBHXHZUZRU-ZBJSNUHESA-N |
| XLogP | 4.97 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|