C29H40F2N2O10S — CID 118011410
N-[2-[2-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-[2,6-difluoro-4-[(E)-2-methyl-3-oxobut-1-enyl]phenoxy]benzenesulfonamide (PubChem CID 118011410) has the molecular formula C29H40F2N2O10S and a molecular weight of 646.71 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-[2,6-difluoro-4-[(E)-2-methyl-3-oxobut-1-enyl]phenoxy]benzenesulfonamide.
| Compound Name | N-[2-[2-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-[2,6-difluoro-4-[(E)-2-methyl-3-oxobut-1-enyl]phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 118011410 |
| Molecular Formula | C29H40F2N2O10S |
| Molecular Weight | 646.71 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-[2,6-difluoro-4-[(E)-2-methyl-3-oxobut-1-enyl]phenoxy]benzenesulfonamide |
| SMILES | CC(=O)/C(C)=C/c1cc(F)c(Oc2ccc(S(=O)(=O)NCCOCCOCCOCCOCCOCCON)cc2)c(F)c1 |
| InChI | InChI=1S/C29H40F2N2O10S/c1-22(23(2)34)19-24-20-27(30)29(28(31)21-24)43-25-3-5-26(6-4-25)44(35,36)33-7-8-37-9-10-38-11-12-39-13-14-40-15-16-41-17-18-42-32/h3-6,19-21,33H,7-18,32H2,1-2H3/b22-19+ |
| InChIKey | HPFJOIGPRHMLFG-ZBJSNUHESA-N |
| XLogP | 3.00 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|