C26H34F2N4O7S — CID 70906024
(E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethylsulfamoyl]phenoxy]phenyl]-2-methylprop-2-enamide (PubChem CID 70906024) has the molecular formula C26H34F2N4O7S and a molecular weight of 584.64 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethylsulfamoyl]phenoxy]phenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethylsulfamoyl]phenoxy]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 70906024 |
| Molecular Formula | C26H34F2N4O7S |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[3,5-difluoro-4-[4-[2-[2-(2-propoxyethoxy)ethoxy]ethylsulfamoyl]phenoxy]phenyl]-2-methylprop-2-enamide |
| SMILES | CCCOCCOCCOCCNS(=O)(=O)c1ccc(Oc2c(F)cc(/C=C(\C)C(=O)N=C(N)N)cc2F)cc1 |
| InChI | InChI=1S/C26H34F2N4O7S/c1-3-9-36-11-13-38-14-12-37-10-8-31-40(34,35)21-6-4-20(5-7-21)39-24-22(27)16-19(17-23(24)28)15-18(2)25(33)32-26(29)30/h4-7,15-17,31H,3,8-14H2,1-2H3,(H4,29,30,32,33)/b18-15+ |
| InChIKey | KZBSSPMVDBFAFE-OBGWFSINSA-N |
| XLogP | 2.70 |
| TPSA | 164.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|